C15H19N3O3 — CID 133438012
[3-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-4-nitrophenyl]methanol (PubChem CID 133438012) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is [3-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-4-nitrophenyl]methanol.
| Compound Name | [3-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 133438012 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [3-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-4-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1N1CCC(N2CC=CC2)C1 |
| InChI | InChI=1S/C15H19N3O3/c19-11-12-3-4-14(18(20)21)15(9-12)17-8-5-13(10-17)16-6-1-2-7-16/h1-4,9,13,19H,5-8,10-11H2 |
| InChIKey | UOOVPZCROXUBNJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|