C18H27N3O3 — CID 133437679
[3-[3-(azepan-1-yl)piperidin-1-yl]-4-nitrophenyl]methanol (PubChem CID 133437679) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is [3-[3-(azepan-1-yl)piperidin-1-yl]-4-nitrophenyl]methanol.
| Compound Name | [3-[3-(azepan-1-yl)piperidin-1-yl]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 133437679 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | [3-[3-(azepan-1-yl)piperidin-1-yl]-4-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1N1CCCC(N2CCCCCC2)C1 |
| InChI | InChI=1S/C18H27N3O3/c22-14-15-7-8-17(21(23)24)18(12-15)20-11-5-6-16(13-20)19-9-3-1-2-4-10-19/h7-8,12,16,22H,1-6,9-11,13-14H2 |
| InChIKey | VIHCEJWTDHUNLB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|