C14H19FN2O — CID 79943710
[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluorophenyl]methanol (PubChem CID 79943710) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is [4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluorophenyl]methanol.
| Compound Name | [4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 79943710 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(N2CCN3CCCC3C2)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O/c15-13-8-11(10-18)3-4-14(13)17-7-6-16-5-1-2-12(16)9-17/h3-4,8,12,18H,1-2,5-7,9-10H2 |
| InChIKey | UHYZXFCPRUKPMJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|