C15H21FN2O — CID 79934838
[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluorophenyl]methanol (PubChem CID 79934838) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is [2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluorophenyl]methanol.
| Compound Name | [2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluorophenyl]methanol |
|---|---|
| PubChem CID | 79934838 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluorophenyl]methanol |
| SMILES | OCc1cc(F)ccc1N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C15H21FN2O/c16-13-4-5-15(12(9-13)11-19)18-8-7-17-6-2-1-3-14(17)10-18/h4-5,9,14,19H,1-3,6-8,10-11H2 |
| InChIKey | WMTVQMABSZCSHZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |