C14H16FN3 — CID 79025974
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-fluorobenzonitrile (PubChem CID 79025974) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-fluorobenzonitrile.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 79025974 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1N1CCN2CCCC2C1 |
| InChI | InChI=1S/C14H16FN3/c15-12-3-4-14(11(8-12)9-16)18-7-6-17-5-1-2-13(17)10-18/h3-4,8,13H,1-2,5-7,10H2 |
| InChIKey | YSMIBPUPCBGBKV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |