C15H20N4 — CID 104716921
2-amino-3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile (PubChem CID 104716921) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-amino-3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile.
| Compound Name | 2-amino-3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 104716921 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-amino-3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(N2CCN3CCCCC3C2)c1N |
| InChI | InChI=1S/C15H20N4/c16-10-12-4-3-6-14(15(12)17)19-9-8-18-7-2-1-5-13(18)11-19/h3-4,6,13H,1-2,5,7-9,11,17H2 |
| InChIKey | NYOQBXLXDJYVDU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|