C14H19IN2 — CID 79929010
2-(2-iodophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 79929010) has the molecular formula C14H19IN2 and a molecular weight of 342.22 g/mol. Its IUPAC name is 2-(2-iodophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-(2-iodophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79929010 |
| Molecular Formula | C14H19IN2 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-(2-iodophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | Ic1ccccc1N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C14H19IN2/c15-13-6-1-2-7-14(13)17-10-9-16-8-4-3-5-12(16)11-17/h1-2,6-7,12H,3-5,8-11H2 |
| InChIKey | BUNUDMOCSXZTJC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|