C14H16FN3 — CID 113284896
2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-5-fluorobenzonitrile (PubChem CID 113284896) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-5-fluorobenzonitrile.
| Compound Name | 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 113284896 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C14H16FN3/c15-11-1-4-14(10(7-11)8-16)18-6-5-12-2-3-13(9-18)17-12/h1,4,7,12-13,17H,2-3,5-6,9H2 |
| InChIKey | ZFZYYGSKNDLHPU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |