About 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile
5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile (PubChem CID 133321116) has the molecular formula C15H16FN5
and a molecular weight of 285.33 g/mol. Its IUPAC name is 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile |
| PubChem CID | 133321116 |
| Molecular Formula | C15H16FN5 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1cc(F)ccc1N1CCCC(Cn2cncn2)C1 |
| InChI | InChI=1S/C15H16FN5/c16-14-3-4-15(13(6-14)7-17)20-5-1-2-12(8-20)9-21-11-18-10-19-21/h3-4,6,10-12H,1-2,5,8-9H2 |
| InChIKey | FBLHCIISCIUMSE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile?
The IUPAC name of 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile (CID 133321116) is 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile.
What is the SMILES notation for 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile?
The canonical SMILES for 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile is N#Cc1cc(F)ccc1N1CCCC(Cn2cncn2)C1.
What is the InChIKey of 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile?
The InChIKey is FBLHCIISCIUMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN5/c16-14-3-4-15(13(6-14)7-17)20-5-1-2-12(8-20)9-21-11-18-10-19-21/h3-4,6,10-12H,1-2,5,8-9H2.
What are the key properties of 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile?
5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile has a molecular weight of 285.33 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[3-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]benzonitrile is sourced from PubChem (CID 133321116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).