C19H29N3O4 — CID 133454460
1-[1-(4,5-dimethoxy-2-nitrophenyl)piperidin-3-yl]azepane (PubChem CID 133454460) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[1-(4,5-dimethoxy-2-nitrophenyl)piperidin-3-yl]azepane.
| Compound Name | 1-[1-(4,5-dimethoxy-2-nitrophenyl)piperidin-3-yl]azepane |
|---|---|
| PubChem CID | 133454460 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-[1-(4,5-dimethoxy-2-nitrophenyl)piperidin-3-yl]azepane |
| SMILES | COc1cc(N2CCCC(N3CCCCCC3)C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H29N3O4/c1-25-18-12-16(17(22(23)24)13-19(18)26-2)21-11-7-8-15(14-21)20-9-5-3-4-6-10-20/h12-13,15H,3-11,14H2,1-2H3 |
| InChIKey | MOPYMRFQUWISHI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|