C17H20FN5O3 — CID 133448726
4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-(2-fluoro-5-methoxy-4-nitrophenyl)piperidine (PubChem CID 133448726) has the molecular formula C17H20FN5O3 and a molecular weight of 361.38 g/mol. Its IUPAC name is 4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-(2-fluoro-5-methoxy-4-nitrophenyl)piperidine.
| Compound Name | 4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-(2-fluoro-5-methoxy-4-nitrophenyl)piperidine |
|---|---|
| PubChem CID | 133448726 |
| Molecular Formula | C17H20FN5O3 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-(2-fluoro-5-methoxy-4-nitrophenyl)piperidine |
| SMILES | COc1cc(N2CCC(c3nncn3C3CC3)CC2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20FN5O3/c1-26-16-9-14(13(18)8-15(16)23(24)25)21-6-4-11(5-7-21)17-20-19-10-22(17)12-2-3-12/h8-12H,2-7H2,1H3 |
| InChIKey | WYRHABVJFKZBHR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|