C16H22FN3O3 — CID 118639741
3-(2-fluoro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 118639741) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-(2-fluoro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(2-fluoro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 118639741 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-(2-fluoro-5-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | COc1cc(N2CCC3(CCNCC3)CC2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22FN3O3/c1-23-15-11-13(12(17)10-14(15)20(21)22)19-8-4-16(5-9-19)2-6-18-7-3-16/h10-11,18H,2-9H2,1H3 |
| InChIKey | SBXLXFGPWQLXDZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|