C23H36N4O3 — CID 164853501
3-(5-methoxy-2-methyl-4-nitrophenyl)-9-(piperidin-4-ylmethyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 164853501) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-(5-methoxy-2-methyl-4-nitrophenyl)-9-(piperidin-4-ylmethyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(5-methoxy-2-methyl-4-nitrophenyl)-9-(piperidin-4-ylmethyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 164853501 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 3-(5-methoxy-2-methyl-4-nitrophenyl)-9-(piperidin-4-ylmethyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | COc1cc(N2CCC3(CCN(CC4CCNCC4)CC3)CC2)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H36N4O3/c1-18-15-21(27(28)29)22(30-2)16-20(18)26-13-7-23(8-14-26)5-11-25(12-6-23)17-19-3-9-24-10-4-19/h15-16,19,24H,3-14,17H2,1-2H3 |
| InChIKey | BYZYXYZERFGKEE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|