C25H39N5O3 — CID 166095360
1-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]-4-(piperidin-4-ylmethyl)piperazine (PubChem CID 166095360) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]-4-(piperidin-4-ylmethyl)piperazine.
| Compound Name | 1-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]-4-(piperidin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 166095360 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | 1-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]-4-(piperidin-4-ylmethyl)piperazine |
| SMILES | COc1cc(N2CCC(N3CCN(CC4CCNCC4)CC3)CC2)c(C2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H39N5O3/c1-33-25-17-23(22(20-2-3-20)16-24(25)30(31)32)29-10-6-21(7-11-29)28-14-12-27(13-15-28)18-19-4-8-26-9-5-19/h16-17,19-21,26H,2-15,18H2,1H3 |
| InChIKey | IPVIMWSTXYRBOI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|