C21H32N4O5S — CID 121454280
N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]cyclohexyl]-3-methoxy-4-nitrobenzenesulfonamide (PubChem CID 121454280) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]cyclohexyl]-3-methoxy-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]cyclohexyl]-3-methoxy-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121454280 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]cyclohexyl]-3-methoxy-4-nitrobenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NC2CCC(N3CCN(CC4CC4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H32N4O5S/c1-30-21-14-19(8-9-20(21)25(26)27)31(28,29)22-17-4-6-18(7-5-17)24-12-10-23(11-13-24)15-16-2-3-16/h8-9,14,16-18,22H,2-7,10-13,15H2,1H3 |
| InChIKey | SFTORSZRENKYPD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|