C14H22N3O5S+ — CID 123199853
methoxy-[2-methoxy-4-[(1-methylpiperidin-4-yl)sulfamoyl]phenyl]-oxoazanium (PubChem CID 123199853) has the molecular formula C14H22N3O5S+ and a molecular weight of 344.41 g/mol. Its IUPAC name is methoxy-[2-methoxy-4-[(1-methylpiperidin-4-yl)sulfamoyl]phenyl]-oxoazanium.
| Compound Name | methoxy-[2-methoxy-4-[(1-methylpiperidin-4-yl)sulfamoyl]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 123199853 |
| Molecular Formula | C14H22N3O5S+ |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methoxy-[2-methoxy-4-[(1-methylpiperidin-4-yl)sulfamoyl]phenyl]-oxoazanium |
| SMILES | COc1cc(S(=O)(=O)NC2CCN(C)CC2)ccc1[N+](=O)OC |
| InChI | InChI=1S/C14H22N3O5S/c1-16-8-6-11(7-9-16)15-23(19,20)12-4-5-13(17(18)22-3)14(10-12)21-2/h4-5,10-11,15H,6-9H2,1-3H3/q+1 |
| InChIKey | AGZMEFAWFLFMOI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|