C19H31N4O5S+ — CID 163933278
CID 163933278 (PubChem CID 163933278) has the molecular formula C19H31N4O5S+ and a molecular weight of 427.55 g/mol.
| Compound Name | CID 163933278 |
|---|---|
| PubChem CID | 163933278 |
| Molecular Formula | C19H31N4O5S+ |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | — |
| SMILES | CCc1cc([N+](=O)[O-])c(OC)cc1N1CCC(N2CCN([S+](C)(=O)O)CC2)CC1 |
| InChI | InChI=1S/C19H30N4O5S/c1-4-15-13-18(23(24)25)19(28-2)14-17(15)21-7-5-16(6-8-21)20-9-11-22(12-10-20)29(3,26)27/h13-14,16H,4-12H2,1-3H3/p+1 |
| InChIKey | RKNMTVANTXSCHA-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|