C20H32N4O5S — CID 59452759
1-[1-(5-ethoxy-2-ethyl-4-nitrophenyl)piperidin-4-yl]-4-methylsulfonylpiperazine (PubChem CID 59452759) has the molecular formula C20H32N4O5S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-[1-(5-ethoxy-2-ethyl-4-nitrophenyl)piperidin-4-yl]-4-methylsulfonylpiperazine.
| Compound Name | 1-[1-(5-ethoxy-2-ethyl-4-nitrophenyl)piperidin-4-yl]-4-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 59452759 |
| Molecular Formula | C20H32N4O5S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[1-(5-ethoxy-2-ethyl-4-nitrophenyl)piperidin-4-yl]-4-methylsulfonylpiperazine |
| SMILES | CCOc1cc(N2CCC(N3CCN(S(C)(=O)=O)CC3)CC2)c(CC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H32N4O5S/c1-4-16-14-19(24(25)26)20(29-5-2)15-18(16)22-8-6-17(7-9-22)21-10-12-23(13-11-21)30(3,27)28/h14-15,17H,4-13H2,1-3H3 |
| InChIKey | RAZJYJLPRQSEOU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|