C19H25F3N4O3 — CID 166872879
1-[1-[2-ethenyl-4-nitro-5-(trifluoromethoxy)phenyl]piperidin-4-yl]-4-methylpiperazine (PubChem CID 166872879) has the molecular formula C19H25F3N4O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is 1-[1-[2-ethenyl-4-nitro-5-(trifluoromethoxy)phenyl]piperidin-4-yl]-4-methylpiperazine.
| Compound Name | 1-[1-[2-ethenyl-4-nitro-5-(trifluoromethoxy)phenyl]piperidin-4-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 166872879 |
| Molecular Formula | C19H25F3N4O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-[1-[2-ethenyl-4-nitro-5-(trifluoromethoxy)phenyl]piperidin-4-yl]-4-methylpiperazine |
| SMILES | C=Cc1cc([N+](=O)[O-])c(OC(F)(F)F)cc1N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C19H25F3N4O3/c1-3-14-12-17(26(27)28)18(29-19(20,21)22)13-16(14)25-6-4-15(5-7-25)24-10-8-23(2)9-11-24/h3,12-13,15H,1,4-11H2,2H3 |
| InChIKey | JYKFPHIPYUUINY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|