C23H34N4O6 — CID 168874453
tert-butyl 4-[1-(2-acetyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 168874453) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-acetyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-acetyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168874453 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | tert-butyl 4-[1-(2-acetyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | COc1cc(N2CCC(N3CCN(C(=O)OC(C)(C)C)CC3)CC2)c(C(C)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H34N4O6/c1-16(28)18-14-20(27(30)31)21(32-5)15-19(18)25-8-6-17(7-9-25)24-10-12-26(13-11-24)22(29)33-23(2,3)4/h14-15,17H,6-13H2,1-5H3 |
| InChIKey | ASZVXHPUEWWTFR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|