C29H45N5O5 — CID 166095537
tert-butyl 3-[[4-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazin-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 166095537) has the molecular formula C29H45N5O5 and a molecular weight of 543.71 g/mol. Its IUPAC name is tert-butyl 3-[[4-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazin-1-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazin-1-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166095537 |
| Molecular Formula | C29H45N5O5 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | tert-butyl 3-[[4-[1-(2-cyclopropyl-5-methoxy-4-nitrophenyl)piperidin-4-yl]piperazin-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cc(N2CCC(N3CCN(CC4CCN(C(=O)OC(C)(C)C)C4)CC3)CC2)c(C2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H45N5O5/c1-29(2,3)39-28(35)33-10-7-21(20-33)19-30-13-15-31(16-14-30)23-8-11-32(12-9-23)25-18-27(38-4)26(34(36)37)17-24(25)22-5-6-22/h17-18,21-23H,5-16,19-20H2,1-4H3 |
| InChIKey | WIHJLFKMRLLZNI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|