C23H36N4O5 — CID 164853490
tert-butyl 4-[[4-(5-methoxy-2-methyl-4-nitrophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 164853490) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl 4-[[4-(5-methoxy-2-methyl-4-nitrophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(5-methoxy-2-methyl-4-nitrophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164853490 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | tert-butyl 4-[[4-(5-methoxy-2-methyl-4-nitrophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | COc1cc(N2CCN(CC3CCN(C(=O)OC(C)(C)C)CC3)CC2)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H36N4O5/c1-17-14-20(27(29)30)21(31-5)15-19(17)25-12-10-24(11-13-25)16-18-6-8-26(9-7-18)22(28)32-23(2,3)4/h14-15,18H,6-13,16H2,1-5H3 |
| InChIKey | NFLOIZROTFCYQT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|