C22H31F3N4O4 — CID 177301053
tert-butyl 4-[[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 177301053) has the molecular formula C22H31F3N4O4 and a molecular weight of 472.51 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177301053 |
| Molecular Formula | C22H31F3N4O4 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl 4-[[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCN(c3ccc([N+](=O)[O-])cc3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C22H31F3N4O4/c1-21(2,3)33-20(30)28-8-6-16(7-9-28)15-26-10-12-27(13-11-26)19-5-4-17(29(31)32)14-18(19)22(23,24)25/h4-5,14,16H,6-13,15H2,1-3H3 |
| InChIKey | DTRMFMYREIMHBW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|