C22H30FN3O4 — CID 140860823
tert-butyl 4-[[4-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 140860823) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is tert-butyl 4-[[4-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140860823 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl 4-[[4-(2-fluoro-4-nitrophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CC=C(c3ccc([N+](=O)[O-])cc3F)CC2)CC1 |
| InChI | InChI=1S/C22H30FN3O4/c1-22(2,3)30-21(27)25-12-6-16(7-13-25)15-24-10-8-17(9-11-24)19-5-4-18(26(28)29)14-20(19)23/h4-5,8,14,16H,6-7,9-13,15H2,1-3H3 |
| InChIKey | OCQORSNQSDCANX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|