C16H20N2O5 — CID 134589298
tert-butyl 3-(2-methoxy-4-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 134589298) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is tert-butyl 3-(2-methoxy-4-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-methoxy-4-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 134589298 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl 3-(2-methoxy-4-nitrophenyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1C1=CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H20N2O5/c1-16(2,3)23-15(19)17-8-7-11(10-17)13-6-5-12(18(20)21)9-14(13)22-4/h5-7,9H,8,10H2,1-4H3 |
| InChIKey | KMGQVIZMDLCVSI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|