C18H21F3N2O7S — CID 167591687
tert-butyl 3-[2-ethyl-3-nitro-4-(trifluoromethylsulfonyloxy)phenyl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 167591687) has the molecular formula C18H21F3N2O7S and a molecular weight of 466.43 g/mol. Its IUPAC name is tert-butyl 3-[2-ethyl-3-nitro-4-(trifluoromethylsulfonyloxy)phenyl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-ethyl-3-nitro-4-(trifluoromethylsulfonyloxy)phenyl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 167591687 |
| Molecular Formula | C18H21F3N2O7S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | tert-butyl 3-[2-ethyl-3-nitro-4-(trifluoromethylsulfonyloxy)phenyl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CCc1c(C2=CCN(C(=O)OC(C)(C)C)C2)ccc(OS(=O)(=O)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21F3N2O7S/c1-5-12-13(11-8-9-22(10-11)16(24)29-17(2,3)4)6-7-14(15(12)23(25)26)30-31(27,28)18(19,20)21/h6-8H,5,9-10H2,1-4H3 |
| InChIKey | WPLOOCQBNZSNHN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|