C15H22F3NO7S — CID 175703009
1-O-tert-butyl 3-O-ethyl (3R)-3-methyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylate (PubChem CID 175703009) has the molecular formula C15H22F3NO7S and a molecular weight of 417.40 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl (3R)-3-methyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl (3R)-3-methyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175703009 |
| Molecular Formula | C15H22F3NO7S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl (3R)-3-methyl-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@]1(C)CN(C(=O)OC(C)(C)C)CC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H22F3NO7S/c1-6-24-11(20)14(5)9-19(12(21)25-13(2,3)4)8-7-10(14)26-27(22,23)15(16,17)18/h7H,6,8-9H2,1-5H3/t14-/m1/s1 |
| InChIKey | CBRJHJAQGLMFIL-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|