C13H20F3NO5S — CID 121317441
[5,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl] trifluoromethanesulfonate (PubChem CID 121317441) has the molecular formula C13H20F3NO5S and a molecular weight of 359.37 g/mol. Its IUPAC name is [5,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl] trifluoromethanesulfonate.
| Compound Name | [5,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121317441 |
| Molecular Formula | C13H20F3NO5S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [5,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1CC=C(OS(=O)(=O)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C13H20F3NO5S/c1-11(2,3)21-10(18)17-8-6-7-9(12(8,4)5)22-23(19,20)13(14,15)16/h7-8H,6H2,1-5H3,(H,17,18) |
| InChIKey | BCCIWMNHVOBNBF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|