C13H20F3NO5S — CID 146168056
[(4S,5R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 146168056) has the molecular formula C13H20F3NO5S and a molecular weight of 359.37 g/mol. Its IUPAC name is [(4S,5R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(4S,5R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146168056 |
| Molecular Formula | C13H20F3NO5S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [(4S,5R)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1CC(OS(=O)(=O)C(F)(F)F)=CC[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20F3NO5S/c1-8-7-9(22-23(19,20)13(14,15)16)5-6-10(8)17-11(18)21-12(2,3)4/h5,8,10H,6-7H2,1-4H3,(H,17,18)/t8-,10+/m1/s1 |
| InChIKey | YIJBRTDHXLKBLR-SCZZXKLOSA-N |
| XLogP | 3.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|