C13H18F3NO7S — CID 90420493
1-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate (PubChem CID 90420493) has the molecular formula C13H18F3NO7S and a molecular weight of 389.35 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90420493 |
| Molecular Formula | C13H18F3NO7S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC(OS(=O)(=O)C(F)(F)F)=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H18F3NO7S/c1-12(2,3)23-11(19)17-6-5-8(7-9(17)10(18)22-4)24-25(20,21)13(14,15)16/h5,9H,6-7H2,1-4H3 |
| InChIKey | QLFLGTYKJPJRLM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|