C16H26F3NO5S — CID 172608101
tert-butyl 2-(1-methylcyclopropyl)-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;ethane (PubChem CID 172608101) has the molecular formula C16H26F3NO5S and a molecular weight of 401.45 g/mol. Its IUPAC name is tert-butyl 2-(1-methylcyclopropyl)-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;ethane.
| Compound Name | tert-butyl 2-(1-methylcyclopropyl)-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;ethane |
|---|---|
| PubChem CID | 172608101 |
| Molecular Formula | C16H26F3NO5S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | tert-butyl 2-(1-methylcyclopropyl)-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC(OS(=O)(=O)C(F)(F)F)=CC1C1(C)CC1 |
| InChI | InChI=1S/C14H20F3NO5S.C2H6/c1-12(2,3)22-11(19)18-8-9(7-10(18)13(4)5-6-13)23-24(20,21)14(15,16)17;1-2/h7,10H,5-6,8H2,1-4H3;1-2H3 |
| InChIKey | BMEIZMDVEKFTNT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|