C18H32F3NO6SSi — CID 140795891
tert-butyl (6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 140795891) has the molecular formula C18H32F3NO6SSi and a molecular weight of 475.60 g/mol. Its IUPAC name is tert-butyl (6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 140795891 |
| Molecular Formula | C18H32F3NO6SSi |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | tert-butyl (6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OS(=O)(=O)C(F)(F)F)=C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32F3NO6SSi/c1-16(2,3)27-15(23)22-10-9-14(28-29(24,25)18(19,20)21)11-13(22)12-26-30(7,8)17(4,5)6/h11,13H,9-10,12H2,1-8H3/t13-/m0/s1 |
| InChIKey | KWTKYXXKTUBBLN-ZDUSSCGKSA-N |
| XLogP | 4.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|