C18H22F3NO5S — CID 129410140
tert-butyl (2S)-2-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 129410140) has the molecular formula C18H22F3NO5S and a molecular weight of 421.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 129410140 |
| Molecular Formula | C18H22F3NO5S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | tert-butyl (2S)-2-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(OS(=O)(=O)C(F)(F)F)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H22F3NO5S/c1-17(2,3)26-16(23)22-10-9-15(27-28(24,25)18(19,20)21)12-14(22)11-13-7-5-4-6-8-13/h4-9,14H,10-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | WUZMNWKVIYTAKJ-AWEZNQCLSA-N |
| XLogP | 3.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|