C24H29F3N2O5S — CID 59324852
tert-butyl (2R)-4-benzyl-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 59324852) has the molecular formula C24H29F3N2O5S and a molecular weight of 514.57 g/mol. Its IUPAC name is tert-butyl (2R)-4-benzyl-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-benzyl-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59324852 |
| Molecular Formula | C24H29F3N2O5S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | tert-butyl (2R)-4-benzyl-2-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)C[C@H]1Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H29F3N2O5S/c1-23(2,3)33-22(30)29-14-13-28(16-19-7-5-4-6-8-19)17-20(29)15-18-9-11-21(12-10-18)34-35(31,32)24(25,26)27/h4-12,20H,13-17H2,1-3H3/t20-/m1/s1 |
| InChIKey | VNXUVRPJLCLOIO-HXUWFJFHSA-N |
| XLogP | 4.58 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|