C18H26F3NO5S2 — CID 142843146
2-methylbutan-2-yl (2R)-2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;sulfane (PubChem CID 142843146) has the molecular formula C18H26F3NO5S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-methylbutan-2-yl (2R)-2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;sulfane.
| Compound Name | 2-methylbutan-2-yl (2R)-2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 142843146 |
| Molecular Formula | C18H26F3NO5S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-methylbutan-2-yl (2R)-2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate;sulfane |
| SMILES | C/C=C\C=C/C=C/[C@@H]1C=C(OS(=O)(=O)C(F)(F)F)CN1C(=O)OC(C)(C)CC.S |
| InChI | InChI=1S/C18H24F3NO5S.H2S/c1-5-7-8-9-10-11-14-12-15(27-28(24,25)18(19,20)21)13-22(14)16(23)26-17(3,4)6-2;/h5,7-12,14H,6,13H2,1-4H3;1H2/b7-5-,9-8-,11-10+;/t14-;/m1./s1 |
| InChIKey | OECWANCIZLHUER-KQHVBWHCSA-N |
| XLogP | 4.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|