C10H11F3O5S — CID 86692389
ethyl (1S,5S,6R)-3-(trifluoromethylsulfonyloxy)bicyclo[3.1.0]hex-2-ene-6-carboxylate (PubChem CID 86692389) has the molecular formula C10H11F3O5S and a molecular weight of 300.25 g/mol. Its IUPAC name is ethyl (1S,5S,6R)-3-(trifluoromethylsulfonyloxy)bicyclo[3.1.0]hex-2-ene-6-carboxylate.
| Compound Name | ethyl (1S,5S,6R)-3-(trifluoromethylsulfonyloxy)bicyclo[3.1.0]hex-2-ene-6-carboxylate |
|---|---|
| PubChem CID | 86692389 |
| Molecular Formula | C10H11F3O5S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | ethyl (1S,5S,6R)-3-(trifluoromethylsulfonyloxy)bicyclo[3.1.0]hex-2-ene-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2C=C(OS(=O)(=O)C(F)(F)F)C[C@@H]21 |
| InChI | InChI=1S/C10H11F3O5S/c1-2-17-9(14)8-6-3-5(4-7(6)8)18-19(15,16)10(11,12)13/h3,6-8H,2,4H2,1H3/t6-,7+,8+/m1/s1 |
| InChIKey | DNIQERSCHGVOCM-CSMHCCOUSA-N |
| XLogP | 1.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|