C11H13F3O5S — CID 86692379
ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 86692379) has the molecular formula C11H13F3O5S and a molecular weight of 314.28 g/mol. Its IUPAC name is ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 86692379 |
| Molecular Formula | C11H13F3O5S |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | ethyl 2-methyl-4-(trifluoromethylsulfonyloxy)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1CC=C(OS(=O)(=O)C(F)(F)F)C=C1C |
| InChI | InChI=1S/C11H13F3O5S/c1-3-18-10(15)9-5-4-8(6-7(9)2)19-20(16,17)11(12,13)14/h4,6,9H,3,5H2,1-2H3 |
| InChIKey | CHOGHIQPVRYLIS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|