C16H14F8O5S — CID 178085575
ethyl 2-[3,4-difluoro-2-(trifluoromethylsulfonyloxy)phenyl]-4-(trifluoromethyl)cyclopentane-1-carboxylate (PubChem CID 178085575) has the molecular formula C16H14F8O5S and a molecular weight of 470.33 g/mol. Its IUPAC name is ethyl 2-[3,4-difluoro-2-(trifluoromethylsulfonyloxy)phenyl]-4-(trifluoromethyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-[3,4-difluoro-2-(trifluoromethylsulfonyloxy)phenyl]-4-(trifluoromethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 178085575 |
| Molecular Formula | C16H14F8O5S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | ethyl 2-[3,4-difluoro-2-(trifluoromethylsulfonyloxy)phenyl]-4-(trifluoromethyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(C(F)(F)F)CC1c1ccc(F)c(F)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H14F8O5S/c1-2-28-14(25)10-6-7(15(19,20)21)5-9(10)8-3-4-11(17)12(18)13(8)29-30(26,27)16(22,23)24/h3-4,7,9-10H,2,5-6H2,1H3 |
| InChIKey | SOSAYTWMHLPBAE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|