C12H9F5O2 — CID 87938295
ethyl 2-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxylate (PubChem CID 87938295) has the molecular formula C12H9F5O2 and a molecular weight of 280.19 g/mol. Its IUPAC name is ethyl 2-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 87938295 |
| Molecular Formula | C12H9F5O2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | ethyl 2-(2,3,4,5,6-pentafluorophenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H9F5O2/c1-2-19-12(18)5-3-4(5)6-7(13)9(15)11(17)10(16)8(6)14/h4-5H,2-3H2,1H3 |
| InChIKey | NNKJFNLGAQBRJT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|