About ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate
ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate (PubChem CID 89415647) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate.
Analyze ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate?
The IUPAC name of ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate (CID 89415647) is ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate is CCOC(=O)C1CC1c1coc(C)n1.
What is the InChIKey of ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate?
The InChIKey is JEIUUTZHXYBSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-3-13-10(12)8-4-7(8)9-5-14-6(2)11-9/h5,7-8H,3-4H2,1-2H3.
What are the key properties of ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate?
ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-methyl-1,3-oxazol-4-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 89415647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).