C11H13NO3 — CID 153293789
ethyl 2-(5-hydroxy-2-pyridinyl)cyclopropane-1-carboxylate (PubChem CID 153293789) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is ethyl 2-(5-hydroxy-2-pyridinyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(5-hydroxy-2-pyridinyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 153293789 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | ethyl 2-(5-hydroxy-2-pyridinyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1c1ccc(O)cn1 |
| InChI | InChI=1S/C11H13NO3/c1-2-15-11(14)9-5-8(9)10-4-3-7(13)6-12-10/h3-4,6,8-9,13H,2,5H2,1H3 |
| InChIKey | OKYWCNIURAMGHJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |