C18H17BrF2N2O2 — CID 142404959
ethyl (1R)-2-[5-[(5-bromo-2,4-difluorophenyl)methylamino]-2-pyridinyl]cyclopropane-1-carboxylate (PubChem CID 142404959) has the molecular formula C18H17BrF2N2O2 and a molecular weight of 411.25 g/mol. Its IUPAC name is ethyl (1R)-2-[5-[(5-bromo-2,4-difluorophenyl)methylamino]-2-pyridinyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl (1R)-2-[5-[(5-bromo-2,4-difluorophenyl)methylamino]-2-pyridinyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 142404959 |
| Molecular Formula | C18H17BrF2N2O2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | ethyl (1R)-2-[5-[(5-bromo-2,4-difluorophenyl)methylamino]-2-pyridinyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC1c1ccc(NCc2cc(Br)c(F)cc2F)cn1 |
| InChI | InChI=1S/C18H17BrF2N2O2/c1-2-25-18(24)13-6-12(13)17-4-3-11(9-23-17)22-8-10-5-14(19)16(21)7-15(10)20/h3-5,7,9,12-13,22H,2,6,8H2,1H3/t12?,13-/m1/s1 |
| InChIKey | VKSCCLDSJCCFRN-ZGTCLIOFSA-N |
| XLogP | 4.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|