C18H17BrF2N2O2 — CID 142335665
trans-ethyl (1R,2R)-2-[6-[(5-bromo-2,4-difluorophenyl)methylamino]-3-pyridinyl]cyclopropane-1-carboxylate (PubChem CID 142335665) has the molecular formula C18H17BrF2N2O2 and a molecular weight of 411.25 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-[6-[(5-bromo-2,4-difluorophenyl)methylamino]-3-pyridinyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-2-[6-[(5-bromo-2,4-difluorophenyl)methylamino]-3-pyridinyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 142335665 |
| Molecular Formula | C18H17BrF2N2O2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | trans-ethyl (1R,2R)-2-[6-[(5-bromo-2,4-difluorophenyl)methylamino]-3-pyridinyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1c1ccc(NCc2cc(Br)c(F)cc2F)nc1 |
| InChI | InChI=1S/C18H17BrF2N2O2/c1-2-25-18(24)13-6-12(13)10-3-4-17(22-8-10)23-9-11-5-14(19)16(21)7-15(11)20/h3-5,7-8,12-13H,2,6,9H2,1H3,(H,22,23)/t12-,13+/m0/s1 |
| InChIKey | JHQNTALOVOZSHN-QWHCGFSZSA-N |
| XLogP | 4.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|