C16H14BrF2N3O2 — CID 175412042
2-[[5-[(5-bromo-2,4-difluorophenyl)methylamino]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid (PubChem CID 175412042) has the molecular formula C16H14BrF2N3O2 and a molecular weight of 398.21 g/mol. Its IUPAC name is 2-[[5-[(5-bromo-2,4-difluorophenyl)methylamino]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[[5-[(5-bromo-2,4-difluorophenyl)methylamino]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 175412042 |
| Molecular Formula | C16H14BrF2N3O2 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2-[[5-[(5-bromo-2,4-difluorophenyl)methylamino]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1Cc1cnc(NCc2cc(Br)c(F)cc2F)cn1 |
| InChI | InChI=1S/C16H14BrF2N3O2/c17-12-3-9(13(18)4-14(12)19)5-21-15-7-20-10(6-22-15)1-8-2-11(8)16(23)24/h3-4,6-8,11H,1-2,5H2,(H,21,22)(H,23,24) |
| InChIKey | UIIPBTUEEHPLLE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|