C11H10F3NO4S — CID 166298336
cis-(1R,2R)-2-[[(2,4,5-trifluorophenyl)sulfonylamino]methyl]cyclopropane-1-carboxylic acid (PubChem CID 166298336) has the molecular formula C11H10F3NO4S and a molecular weight of 309.27 g/mol. Its IUPAC name is cis-(1R,2R)-2-[[(2,4,5-trifluorophenyl)sulfonylamino]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-2-[[(2,4,5-trifluorophenyl)sulfonylamino]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 166298336 |
| Molecular Formula | C11H10F3NO4S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | cis-(1R,2R)-2-[[(2,4,5-trifluorophenyl)sulfonylamino]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]1CNS(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H10F3NO4S/c12-7-2-9(14)10(3-8(7)13)20(18,19)15-4-5-1-6(5)11(16)17/h2-3,5-6,15H,1,4H2,(H,16,17)/t5-,6+/m0/s1 |
| InChIKey | RKTATEFIFBFFTE-NTSWFWBYSA-N |
| XLogP | 1.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|