C12H14FNO3 — CID 115221253
2-[(3-fluoro-4-methoxyanilino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 115221253) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methoxyanilino)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[(3-fluoro-4-methoxyanilino)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115221253 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-[(3-fluoro-4-methoxyanilino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | COc1ccc(NCC2CC2C(=O)O)cc1F |
| InChI | InChI=1S/C12H14FNO3/c1-17-11-3-2-8(5-10(11)13)14-6-7-4-9(7)12(15)16/h2-3,5,7,9,14H,4,6H2,1H3,(H,15,16) |
| InChIKey | GWHNFRDOCCWYAR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|