C14H19FN2O2 — CID 61488261
N-cyclopropyl-N-ethyl-2-(3-fluoro-4-methoxyanilino)acetamide (PubChem CID 61488261) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-2-(3-fluoro-4-methoxyanilino)acetamide.
| Compound Name | N-cyclopropyl-N-ethyl-2-(3-fluoro-4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 61488261 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-cyclopropyl-N-ethyl-2-(3-fluoro-4-methoxyanilino)acetamide |
| SMILES | CCN(C(=O)CNc1ccc(OC)c(F)c1)C1CC1 |
| InChI | InChI=1S/C14H19FN2O2/c1-3-17(11-5-6-11)14(18)9-16-10-4-7-13(19-2)12(15)8-10/h4,7-8,11,16H,3,5-6,9H2,1-2H3 |
| InChIKey | PWNKEPWMGFXLMW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|