C19H29N3O3 — CID 55437224
2-(5-acetamido-2-methoxyanilino)-N-cyclohexyl-N-ethylacetamide (PubChem CID 55437224) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-(5-acetamido-2-methoxyanilino)-N-cyclohexyl-N-ethylacetamide.
| Compound Name | 2-(5-acetamido-2-methoxyanilino)-N-cyclohexyl-N-ethylacetamide |
|---|---|
| PubChem CID | 55437224 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-(5-acetamido-2-methoxyanilino)-N-cyclohexyl-N-ethylacetamide |
| SMILES | CCN(C(=O)CNc1cc(NC(C)=O)ccc1OC)C1CCCCC1 |
| InChI | InChI=1S/C19H29N3O3/c1-4-22(16-8-6-5-7-9-16)19(24)13-20-17-12-15(21-14(2)23)10-11-18(17)25-3/h10-12,16,20H,4-9,13H2,1-3H3,(H,21,23) |
| InChIKey | JZQNNSMNDZCOCH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |