C17H26N2O6S — CID 109003567
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 109003567) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 109003567 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | CCN(C(=O)CNc1cc(OC)c(OC)c(OC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O6S/c1-5-19(13-6-7-26(21,22)11-13)16(20)10-18-12-8-14(23-2)17(25-4)15(9-12)24-3/h8-9,13,18H,5-7,10-11H2,1-4H3 |
| InChIKey | HBDRQNUUZOMRHN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|