C16H22N2O5S — CID 109003562
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide (PubChem CID 109003562) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 109003562 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)CNc1ccc2c(c1)OCCO2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O5S/c1-2-18(13-5-8-24(20,21)11-13)16(19)10-17-12-3-4-14-15(9-12)23-7-6-22-14/h3-4,9,13,17H,2,5-8,10-11H2,1H3 |
| InChIKey | RWLKQVUCEQCUIK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|